| CAS No: | 146877-90-9 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 1049.22 |
| Formula: | C47H80N14O13 |
| SMILES: | O=C(N[C@@H](CCCCN)C(N[C@@H](CCC(O)=O)C(N[C@@H]([C@H](O)C)C(N[C@@H](CC(C)C)C(N[C@@H](CCC(N)=O)C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CCCNC(N)=N)C(O)=O)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)N |
| Purity: | 99.82 |
| Description: | CMX-8933 is an octapeptide fragment of the goldfish brain neurotrophic factor ependymin. CMX-8933 increases the enzymatic activity of c-Jun N-terminal kinase (JNK), increases the phosphorylation of JNK and c-Jun proteins, and increases the cellular levels of c-Jun and c-Fos mRNA. CMX-8933 can be used to study the role of ependymin in neuroplasticity, learning, memory formation, and neural regeneration[1]. |
| Shipping Conditions: | Ship on cold packs |
| Storage: | -80°C, 2 years; -20°C, 1 year (Powder, sealed storage, away from moisture) |
| Usage: | Research Use only |
