(-)-Denudatin B [CAS 87402-88-8]
Partner: MedChemexpress LLC
| CAS No: | 87402-88-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 356.41 |
| Formula: | C21H24O5 |
| SMILES: | CO[C@@]12C(O[C@@](C3=CC(OC)=C(C=C3)OC)([H])[C@H]1C)=CC(C(CC=C)=C2)=O |
| Purity: | 97.0 |
| Description: | (-)-Denudatin B is an antiplatelet agent. (-)-Denudatin B relaxed vascular smooth muscle by inhibiting the Ca2+ influx through voltage-gated and receptor-operated Ca2+ channels[1]. And (-)-Denudatin B has nonspecific antiplatelet action |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
