(+)-Medioresinol [CAS 40957-99-1]
Partner: MedChemexpress LLC
| CAS No: | 40957-99-1 |
| Applications: | COVID-19-immunoregulation |
| MW: | 388.41 |
| Formula: | C21H24O7 |
| SMILES: | COC1=C(O)C(OC)=CC([C@]2([H])[C@]3([H])[C@@](CO2)([H])[C@](C4=CC(OC)=C(C=C4)O)([H])OC3)=C1 |
| Purity: | 98.88 |
| Description: | (+)-Medioresinol is a furofuran type lignan with antifungal, antibacterial and lesishmanicidal activities. (+)-Medioresinol leads to intracellular ROS accumulation and mitochondria-mediated apoptotic cell death in Candida albicans. (+)-Medioresinol can reduce the cardiovascular disease risk[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
