(+)-Columbianetin acetate [CAS 23180-65-6]
Partner: MedChemexpress LLC
| CAS No: | 23180-65-6 |
| Applications: | COVID-19-immunoregulation |
| MW: | 288.30 |
| Formula: | C16H16O5 |
| SMILES: | O=C1C=CC2=C(C3=C(O[C@H](C(C)(OC(C)=O)C)C3)C=C2)O1 |
| Purity: | 99.71 |
| Description: | (S)-Columbianetin acetate is an isomer of Columbianetin. Columbianetin is a phytoalexin associated with celery (Apium graveolens) resistance to pathogens during storage. Columbianetin exhibits excellent anti-fungal and anti-inflammatory activity[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
