(+)-Columbianetin [CAS 3804-70-4]
Partner: MedChemexpress LLC
| CAS No: | 3804-70-4 |
| Applications: | COVID-19-immunoregulation |
| MW: | 246.26 |
| Formula: | C14H14O4 |
| SMILES: | O=C1C=CC2=CC=C(O[C@H](C(C)(O)C)C3)C3=C2O1 |
| Purity: | 99.04 |
| Description: | (+)-Columbianetin is an isomer of Columbianetin. Columbianetin is a phytoalexin associated with celery (Apium graveolens) resistance to pathogens during storage. Columbianetin exhibits excellent anti-fungal and anti-inflammatory activity[1][2]. |
| Shipping Conditions: | Ship at ambient |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
