(-)-(S)-B-973B [CAS2244989-34-0]
Partner: MedChemexpress LLC
| CAS No: | 2244989-34-0 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 452.50 |
| Formula: | C24H26F2N6O |
| SMILES: | O=C(N[C@H](C1=NC(N2CCN(C3=NC=CC=C3)CC2)=CN=C1)C)CCC4=CC=C(F)C(F)=C4 |
| Purity: | 99.22 |
| Description: | (-)-(S)-B-973B is a potent allosteric agonist and positive allosteric modulator of α7 nAChR, with antinociceptive activity[1]. |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20°C, 3 years; 4°C, 2 years (Powder) |
| Usage: | Research Use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
