(-)-Vesamicol [CAS112709-59-8]
Partner: MedChemexpress LLC
| CAS No: | 112709-59-8 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 259.39 |
| Formula: | C17H25NO |
| SMILES: | O[C@H]1[C@H](N2CCC(C3=CC=CC=C3)CC2)CCCC1 |
| Purity: | 98.09 |
| Description: | (-)-Vesamicol (AH5183) is an inhibitor of acetylcholine transport into synaptic vesicles, with the IC50 of 75 nM[1]. (-)-Vesamicol can be used for release and recycling of synaptic vesicles study[1]. |
| Shipping Conditions: | Ship at ambient |
| Storage: | -20°C, 3 years; 4°C, 2 years (Powder) |
| Usage: | Research Use only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
