8-CPT-2Me-cAMP (sodium) [CAS 634207-53-7]
Partner: MedChemexpress LLC
| CAS No: | 634207-53-7 |
| Applications: | Neuroscience-Neuromodulation |
| MW: | 507.82 |
| Formula: | C17H16ClN5NaO6PS |
| SMILES: | NC1=C2C(N([C@H]3[C@@H]([C@@](O4)([H])[C@](COP4(O[Na])=O)([H])O3)OC)C(SC5=CC=C(Cl)C=C5)=N2)=NC=N1 |
| Purity: | 99.58 |
| Description: | 8-CPT-2Me-cAMP sodium is a selective activator of exchange proteins activated by cAMP (Epac), the cAMP sensitive guanine nucleotide exchange factors (GEFs) for the small GTPases Rap1 and Rap2. 8-CPT-2Me-cAMP sodium activates Epac1 (EC50 = 2.2 μM), but not PKA (EC50> 10 μM)[1]. 8-CPT-2Me-cAMP sodium stimulates Epac-mediated Ca2+ release in pancreatic β-cells in vitro[2]. |
| Shipping Conditions: | Ship on cold packs |
| Usage: | Research Use Only |
Insight Biotechnology Ltd reserves the right to change pricing without notice
